C29H24N4O6 — CID 98171700
[4-[(3R,3aR,6aS)-4,6-dioxo-2,5-diphenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]-2-methoxyphenyl] 2-methylpyrazole-3-carboxylate (PubChem CID 98171700) has the molecular formula C29H24N4O6 and a molecular weight of 524.53 g/mol. Its IUPAC name is [4-[(3R,3aR,6aS)-4,6-dioxo-2,5-diphenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]-2-methoxyphenyl] 2-methylpyrazole-3-carboxylate.
| Compound Name | [4-[(3R,3aR,6aS)-4,6-dioxo-2,5-diphenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]-2-methoxyphenyl] 2-methylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 98171700 |
| Molecular Formula | C29H24N4O6 |
| Molecular Weight | 524.53 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | [4-[(3R,3aR,6aS)-4,6-dioxo-2,5-diphenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]-2-methoxyphenyl] 2-methylpyrazole-3-carboxylate |
| SMILES | COc1cc([C@H]2[C@H]3C(=O)N(c4ccccc4)C(=O)[C@H]3ON2c2ccccc2)ccc1OC(=O)c1ccnn1C |
| InChI | InChI=1S/C29H24N4O6/c1-31-21(15-16-30-31)29(36)38-22-14-13-18(17-23(22)37-2)25-24-26(39-33(25)20-11-7-4-8-12-20)28(35)32(27(24)34)19-9-5-3-6-10-19/h3-17,24-26H,1-2H3/t24-,25+,26+/m1/s1 |
| InChIKey | OQJYFRXZUDHKGP-ZNZIZOMTSA-N |
| XLogP | 3.70 |
| TPSA | 103.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.53 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|