C26H18ClF3N2O5 — CID 98171773
methyl 4-[(3R,3aR,6aS)-2-(4-chlorophenyl)-4,6-dioxo-3-[4-(trifluoromethyl)phenyl]-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate (PubChem CID 98171773) has the molecular formula C26H18ClF3N2O5 and a molecular weight of 530.89 g/mol. Its IUPAC name is methyl 4-[(3R,3aR,6aS)-2-(4-chlorophenyl)-4,6-dioxo-3-[4-(trifluoromethyl)phenyl]-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate.
| Compound Name | methyl 4-[(3R,3aR,6aS)-2-(4-chlorophenyl)-4,6-dioxo-3-[4-(trifluoromethyl)phenyl]-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate |
|---|---|
| PubChem CID | 98171773 |
| Molecular Formula | C26H18ClF3N2O5 |
| Molecular Weight | 530.89 g/mol |
| Exact Mass | 530.09 |
| IUPAC Name | methyl 4-[(3R,3aR,6aS)-2-(4-chlorophenyl)-4,6-dioxo-3-[4-(trifluoromethyl)phenyl]-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)[C@H]3[C@H](ON(c4ccc(Cl)cc4)[C@H]3c3ccc(C(F)(F)F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H18ClF3N2O5/c1-36-25(35)15-4-10-18(11-5-15)31-23(33)20-21(14-2-6-16(7-3-14)26(28,29)30)32(37-22(20)24(31)34)19-12-8-17(27)9-13-19/h2-13,20-22H,1H3/t20-,21+,22+/m1/s1 |
| InChIKey | BVHGOJINBRCZKA-FSSWDIPSSA-N |
| XLogP | 5.20 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.89 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|