C24H17N3O5 — CID 10477606
methyl (1S,12S,13R,17R)-3,14,16-trioxo-15-phenyl-2,10,15-triazapentacyclo[10.5.2.02,11.04,9.013,17]nonadeca-4,6,8,10,18-pentaene-18-carboxylate (PubChem CID 10477606) has the molecular formula C24H17N3O5 and a molecular weight of 427.42 g/mol. Its IUPAC name is methyl (1S,12S,13R,17R)-3,14,16-trioxo-15-phenyl-2,10,15-triazapentacyclo[10.5.2.02,11.04,9.013,17]nonadeca-4,6,8,10,18-pentaene-18-carboxylate.
| Compound Name | methyl (1S,12S,13R,17R)-3,14,16-trioxo-15-phenyl-2,10,15-triazapentacyclo[10.5.2.02,11.04,9.013,17]nonadeca-4,6,8,10,18-pentaene-18-carboxylate |
|---|---|
| PubChem CID | 10477606 |
| Molecular Formula | C24H17N3O5 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | methyl (1S,12S,13R,17R)-3,14,16-trioxo-15-phenyl-2,10,15-triazapentacyclo[10.5.2.02,11.04,9.013,17]nonadeca-4,6,8,10,18-pentaene-18-carboxylate |
| SMILES | COC(=O)C1=C[C@@H]2c3nc4ccccc4c(=O)n3[C@H]1[C@@H]1C(=O)N(c3ccccc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C24H17N3O5/c1-32-24(31)15-11-14-17-18(23(30)26(22(17)29)12-7-3-2-4-8-12)19(15)27-20(14)25-16-10-6-5-9-13(16)21(27)28/h2-11,14,17-19H,1H3/t14-,17+,18+,19+/m0/s1 |
| InChIKey | MXRVIVGYJRGAGB-JEDBISTDSA-N |
| XLogP | 1.95 |
| TPSA | 98.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|