C17H14N2O5 — CID 142743519
methyl 3,5,10-trioxo-4-phenyl-4,11-diazatricyclo[5.3.1.02,6]undec-8-ene-11-carboxylate (PubChem CID 142743519) has the molecular formula C17H14N2O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is methyl 3,5,10-trioxo-4-phenyl-4,11-diazatricyclo[5.3.1.02,6]undec-8-ene-11-carboxylate.
| Compound Name | methyl 3,5,10-trioxo-4-phenyl-4,11-diazatricyclo[5.3.1.02,6]undec-8-ene-11-carboxylate |
|---|---|
| PubChem CID | 142743519 |
| Molecular Formula | C17H14N2O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | methyl 3,5,10-trioxo-4-phenyl-4,11-diazatricyclo[5.3.1.02,6]undec-8-ene-11-carboxylate |
| SMILES | COC(=O)N1C2C=CC(=O)C1C1C(=O)N(c3ccccc3)C(=O)C12 |
| InChI | InChI=1S/C17H14N2O5/c1-24-17(23)19-10-7-8-11(20)14(19)13-12(10)15(21)18(16(13)22)9-5-3-2-4-6-9/h2-8,10,12-14H,1H3 |
| InChIKey | WTWIUIHWNGHRKW-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|