C23H19FN2O3 — CID 126590019
(1S,2R,7S)-11-[(4-fluoro-3-methylphenyl)methyl]-4-phenyl-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione (PubChem CID 126590019) has the molecular formula C23H19FN2O3 and a molecular weight of 390.41 g/mol. Its IUPAC name is (1S,2R,7S)-11-[(4-fluoro-3-methylphenyl)methyl]-4-phenyl-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione.
| Compound Name | (1S,2R,7S)-11-[(4-fluoro-3-methylphenyl)methyl]-4-phenyl-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione |
|---|---|
| PubChem CID | 126590019 |
| Molecular Formula | C23H19FN2O3 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | (1S,2R,7S)-11-[(4-fluoro-3-methylphenyl)methyl]-4-phenyl-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione |
| SMILES | Cc1cc(CN2[C@@H]3C(=O)C=C[C@H]2[C@@H]2C(=O)N(c4ccccc4)C(=O)C23)ccc1F |
| InChI | InChI=1S/C23H19FN2O3/c1-13-11-14(7-8-16(13)24)12-25-17-9-10-18(27)21(25)20-19(17)22(28)26(23(20)29)15-5-3-2-4-6-15/h2-11,17,19-21H,12H2,1H3/t17-,19-,20?,21+/m0/s1 |
| InChIKey | LXHLVMVBDQUQLN-MLKZNYSHSA-N |
| XLogP | 2.63 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|