C25H26N2O3 — CID 158292076
1-ethyl-3,5-dimethylbenzene;(1S,2R,6S,7S)-4-phenyl-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione (PubChem CID 158292076) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is 1-ethyl-3,5-dimethylbenzene;(1S,2R,6S,7S)-4-phenyl-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione.
| Compound Name | 1-ethyl-3,5-dimethylbenzene;(1S,2R,6S,7S)-4-phenyl-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione |
|---|---|
| PubChem CID | 158292076 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 1-ethyl-3,5-dimethylbenzene;(1S,2R,6S,7S)-4-phenyl-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione |
| SMILES | CCc1cc(C)cc(C)c1.O=C1C=C[C@@H]2N[C@H]1[C@H]1C(=O)N(c3ccccc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C15H12N2O3.C10H14/c18-10-7-6-9-11-12(13(10)16-9)15(20)17(14(11)19)8-4-2-1-3-5-8;1-4-10-6-8(2)5-9(3)7-10/h1-7,9,11-13,16H;5-7H,4H2,1-3H3/t9-,11-,12-,13+;/m0./s1 |
| InChIKey | GLLZNOIJEVWBKJ-WRXPESLUSA-N |
| XLogP | 3.14 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|