C22H19N2O3+ — CID 3752453
11-methyl-4,11-diphenyl-4-aza-11-azoniatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione (PubChem CID 3752453) has the molecular formula C22H19N2O3+ and a molecular weight of 359.40 g/mol. Its IUPAC name is 11-methyl-4,11-diphenyl-4-aza-11-azoniatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione.
| Compound Name | 11-methyl-4,11-diphenyl-4-aza-11-azoniatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione |
|---|---|
| PubChem CID | 3752453 |
| Molecular Formula | C22H19N2O3+ |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 11-methyl-4,11-diphenyl-4-aza-11-azoniatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione |
| SMILES | C[N+]1(c2ccccc2)C2C=CC(=O)C1C1C(=O)N(c3ccccc3)C(=O)C12 |
| InChI | InChI=1S/C22H19N2O3/c1-24(15-10-6-3-7-11-15)16-12-13-17(25)20(24)19-18(16)21(26)23(22(19)27)14-8-4-2-5-9-14/h2-13,16,18-20H,1H3/q+1 |
| InChIKey | XSNPQKRBDVDORE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|