C24H21F3N2O3 — CID 157089173
1-ethyl-3-(trifluoromethyl)benzene;4-phenyl-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione (PubChem CID 157089173) has the molecular formula C24H21F3N2O3 and a molecular weight of 442.44 g/mol. Its IUPAC name is 1-ethyl-3-(trifluoromethyl)benzene;4-phenyl-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione.
| Compound Name | 1-ethyl-3-(trifluoromethyl)benzene;4-phenyl-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione |
|---|---|
| PubChem CID | 157089173 |
| Molecular Formula | C24H21F3N2O3 |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 1-ethyl-3-(trifluoromethyl)benzene;4-phenyl-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione |
| SMILES | CCc1cccc(C(F)(F)F)c1.O=C1C=CC2NC1C1C(=O)N(c3ccccc3)C(=O)C21 |
| InChI | InChI=1S/C15H12N2O3.C9H9F3/c18-10-7-6-9-11-12(13(10)16-9)15(20)17(14(11)19)8-4-2-1-3-5-8;1-2-7-4-3-5-8(6-7)9(10,11)12/h1-7,9,11-13,16H;3-6H,2H2,1H3 |
| InChIKey | AELMGPDVDXVKGJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|