C17H12F3NOS2 — CID 2463018
(5R)-3-phenyl-2-sulfanylidene-5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidin-4-one (PubChem CID 2463018) has the molecular formula C17H12F3NOS2 and a molecular weight of 367.42 g/mol. Its IUPAC name is (5R)-3-phenyl-2-sulfanylidene-5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidin-4-one.
| Compound Name | (5R)-3-phenyl-2-sulfanylidene-5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2463018 |
| Molecular Formula | C17H12F3NOS2 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | (5R)-3-phenyl-2-sulfanylidene-5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidin-4-one |
| SMILES | O=C1[C@@H](Cc2cccc(C(F)(F)F)c2)SC(=S)N1c1ccccc1 |
| InChI | InChI=1S/C17H12F3NOS2/c18-17(19,20)12-6-4-5-11(9-12)10-14-15(22)21(16(23)24-14)13-7-2-1-3-8-13/h1-9,14H,10H2/t14-/m1/s1 |
| InChIKey | IKYRPEPKAAQHAO-CQSZACIVSA-N |
| XLogP | 4.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|