C17H10F3N2NaO4S4 — CID 44561738
sodium 4-[[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidine-5-carbothioyl]amino]benzenesulfonate (PubChem CID 44561738) has the molecular formula C17H10F3N2NaO4S4 and a molecular weight of 514.53 g/mol. Its IUPAC name is sodium 4-[[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidine-5-carbothioyl]amino]benzenesulfonate.
| Compound Name | sodium 4-[[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidine-5-carbothioyl]amino]benzenesulfonate |
|---|---|
| PubChem CID | 44561738 |
| Molecular Formula | C17H10F3N2NaO4S4 |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 513.94 |
| IUPAC Name | sodium 4-[[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidine-5-carbothioyl]amino]benzenesulfonate |
| SMILES | O=C1C(C(=S)Nc2ccc(S(=O)(=O)[O-])cc2)SC(=S)N1c1cccc(C(F)(F)F)c1.[Na+] |
| InChI | InChI=1S/C17H11F3N2O4S4.Na/c18-17(19,20)9-2-1-3-11(8-9)22-15(23)13(29-16(22)28)14(27)21-10-4-6-12(7-5-10)30(24,25)26;/h1-8,13H,(H,21,27)(H,24,25,26);/q;+1/p-1 |
| InChIKey | LYLLWPOBZIAIDO-UHFFFAOYSA-M |
| XLogP | 0.79 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|