C18H11F3N2O4S3 — CID 44561740
2-hydroxy-4-[[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidine-5-carbothioyl]amino]benzoic acid (PubChem CID 44561740) has the molecular formula C18H11F3N2O4S3 and a molecular weight of 472.49 g/mol. Its IUPAC name is 2-hydroxy-4-[[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidine-5-carbothioyl]amino]benzoic acid.
| Compound Name | 2-hydroxy-4-[[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidine-5-carbothioyl]amino]benzoic acid |
|---|---|
| PubChem CID | 44561740 |
| Molecular Formula | C18H11F3N2O4S3 |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 471.98 |
| IUPAC Name | 2-hydroxy-4-[[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidine-5-carbothioyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=S)C2SC(=S)N(c3cccc(C(F)(F)F)c3)C2=O)cc1O |
| InChI | InChI=1S/C18H11F3N2O4S3/c19-18(20,21)8-2-1-3-10(6-8)23-15(25)13(30-17(23)29)14(28)22-9-4-5-11(16(26)27)12(24)7-9/h1-7,13,24H,(H,22,28)(H,26,27) |
| InChIKey | NPRZPFHQQHKIFR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|