C19H16N2O7S — CID 43863903
2-hydroxy-4-[[2-[3-(3-methoxyphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoic acid (PubChem CID 43863903) has the molecular formula C19H16N2O7S and a molecular weight of 416.41 g/mol. Its IUPAC name is 2-hydroxy-4-[[2-[3-(3-methoxyphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoic acid.
| Compound Name | 2-hydroxy-4-[[2-[3-(3-methoxyphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 43863903 |
| Molecular Formula | C19H16N2O7S |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 2-hydroxy-4-[[2-[3-(3-methoxyphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoic acid |
| SMILES | COc1cccc(N2C(=O)SC(CC(=O)Nc3ccc(C(=O)O)c(O)c3)C2=O)c1 |
| InChI | InChI=1S/C19H16N2O7S/c1-28-12-4-2-3-11(8-12)21-17(24)15(29-19(21)27)9-16(23)20-10-5-6-13(18(25)26)14(22)7-10/h2-8,15,22H,9H2,1H3,(H,20,23)(H,25,26) |
| InChIKey | UXOKIUMGILMZTR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_D(3)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|