C21H18N2O8S — CID 43863826
5-[[2-[3-(4-ethoxyphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetyl]amino]benzene-1,3-dicarboxylic acid (PubChem CID 43863826) has the molecular formula C21H18N2O8S and a molecular weight of 458.45 g/mol. Its IUPAC name is 5-[[2-[3-(4-ethoxyphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetyl]amino]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[[2-[3-(4-ethoxyphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetyl]amino]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 43863826 |
| Molecular Formula | C21H18N2O8S |
| Molecular Weight | 458.45 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | 5-[[2-[3-(4-ethoxyphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetyl]amino]benzene-1,3-dicarboxylic acid |
| SMILES | CCOc1ccc(N2C(=O)SC(CC(=O)Nc3cc(C(=O)O)cc(C(=O)O)c3)C2=O)cc1 |
| InChI | InChI=1S/C21H18N2O8S/c1-2-31-15-5-3-14(4-6-15)23-18(25)16(32-21(23)30)10-17(24)22-13-8-11(19(26)27)7-12(9-13)20(28)29/h3-9,16H,2,10H2,1H3,(H,22,24)(H,26,27)(H,28,29) |
| InChIKey | CUUQCYXIXOBZBO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_D(3)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|