C18H13FN2O6S — CID 43863951
4-[[2-[3-(4-fluorophenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetyl]amino]-2-hydroxybenzoic acid (PubChem CID 43863951) has the molecular formula C18H13FN2O6S and a molecular weight of 404.38 g/mol. Its IUPAC name is 4-[[2-[3-(4-fluorophenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[[2-[3-(4-fluorophenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 43863951 |
| Molecular Formula | C18H13FN2O6S |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 4-[[2-[3-(4-fluorophenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetyl]amino]-2-hydroxybenzoic acid |
| SMILES | O=C(CC1SC(=O)N(c2ccc(F)cc2)C1=O)Nc1ccc(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C18H13FN2O6S/c19-9-1-4-11(5-2-9)21-16(24)14(28-18(21)27)8-15(23)20-10-3-6-12(17(25)26)13(22)7-10/h1-7,14,22H,8H2,(H,20,23)(H,25,26) |
| InChIKey | UAXYBHWZIAWMFJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_D(3)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|