C19H13ClN2O7S — CID 43863974
2-[[2-[3-(4-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetyl]amino]terephthalic acid (PubChem CID 43863974) has the molecular formula C19H13ClN2O7S and a molecular weight of 448.84 g/mol. Its IUPAC name is 2-[[2-[3-(4-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetyl]amino]terephthalic acid.
| Compound Name | 2-[[2-[3-(4-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetyl]amino]terephthalic acid |
|---|---|
| PubChem CID | 43863974 |
| Molecular Formula | C19H13ClN2O7S |
| Molecular Weight | 448.84 g/mol |
| Exact Mass | 448.01 |
| IUPAC Name | 2-[[2-[3-(4-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetyl]amino]terephthalic acid |
| SMILES | O=C(CC1SC(=O)N(c2ccc(Cl)cc2)C1=O)Nc1cc(C(=O)O)ccc1C(=O)O |
| InChI | InChI=1S/C19H13ClN2O7S/c20-10-2-4-11(5-3-10)22-16(24)14(30-19(22)29)8-15(23)21-13-7-9(17(25)26)1-6-12(13)18(27)28/h1-7,14H,8H2,(H,21,23)(H,25,26)(H,27,28) |
| InChIKey | VYCUJDREZFRFGS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.84 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_D(3)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|