C11H8ClNO4S — CID 51859703
2-[(5S)-3-(4-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 51859703) has the molecular formula C11H8ClNO4S and a molecular weight of 285.71 g/mol. Its IUPAC name is 2-[(5S)-3-(4-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[(5S)-3-(4-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 51859703 |
| Molecular Formula | C11H8ClNO4S |
| Molecular Weight | 285.71 g/mol |
| Exact Mass | 284.99 |
| IUPAC Name | 2-[(5S)-3-(4-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1SC(=O)N(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C11H8ClNO4S/c12-6-1-3-7(4-2-6)13-10(16)8(5-9(14)15)18-11(13)17/h1-4,8H,5H2,(H,14,15)/t8-/m0/s1 |
| InChIKey | DQZYRCPWEVAJNC-QMMMGPOBSA-N |
| XLogP | 2.38 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.71 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|