C15H15NO5S — CID 7041647
2-[(5R)-3-(4-methoxyphenyl)-4-oxo-2-(2-oxopropylidene)-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 7041647) has the molecular formula C15H15NO5S and a molecular weight of 321.35 g/mol. Its IUPAC name is 2-[(5R)-3-(4-methoxyphenyl)-4-oxo-2-(2-oxopropylidene)-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[(5R)-3-(4-methoxyphenyl)-4-oxo-2-(2-oxopropylidene)-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 7041647 |
| Molecular Formula | C15H15NO5S |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 2-[(5R)-3-(4-methoxyphenyl)-4-oxo-2-(2-oxopropylidene)-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | COc1ccc(N2C(=O)[C@@H](CC(=O)O)SC2=CC(C)=O)cc1 |
| InChI | InChI=1S/C15H15NO5S/c1-9(17)7-13-16(10-3-5-11(21-2)6-4-10)15(20)12(22-13)8-14(18)19/h3-7,12H,8H2,1-2H3,(H,18,19)/t12-/m1/s1 |
| InChIKey | PDHXMLKBOAKSBV-GFCCVEGCSA-N |
| XLogP | 2.05 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|