C18H22N2O4S — CID 6977368
2-[(5R)-2-cyclohexylimino-3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 6977368) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is 2-[(5R)-2-cyclohexylimino-3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[(5R)-2-cyclohexylimino-3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 6977368 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 2-[(5R)-2-cyclohexylimino-3-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | COc1ccc(N2C(=O)[C@@H](CC(=O)O)S/C2=N\C2CCCCC2)cc1 |
| InChI | InChI=1S/C18H22N2O4S/c1-24-14-9-7-13(8-10-14)20-17(23)15(11-16(21)22)25-18(20)19-12-5-3-2-4-6-12/h7-10,12,15H,2-6,11H2,1H3,(H,21,22)/b19-18-/t15-/m1/s1 |
| InChIKey | XSVCNYJGMXUJIS-RAJOGRCSSA-N |
| XLogP | 3.31 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|