C20H29N3O2S — CID 67348430
2-(2-cyclohexylimino-3,5-dimethyl-1,3-thiazolidin-4-yl)-N-(4-methoxyphenyl)acetamide (PubChem CID 67348430) has the molecular formula C20H29N3O2S and a molecular weight of 375.54 g/mol. Its IUPAC name is 2-(2-cyclohexylimino-3,5-dimethyl-1,3-thiazolidin-4-yl)-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-(2-cyclohexylimino-3,5-dimethyl-1,3-thiazolidin-4-yl)-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 67348430 |
| Molecular Formula | C20H29N3O2S |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 2-(2-cyclohexylimino-3,5-dimethyl-1,3-thiazolidin-4-yl)-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CC2C(C)S/C(=N\C3CCCCC3)N2C)cc1 |
| InChI | InChI=1S/C20H29N3O2S/c1-14-18(13-19(24)21-16-9-11-17(25-3)12-10-16)23(2)20(26-14)22-15-7-5-4-6-8-15/h9-12,14-15,18H,4-8,13H2,1-3H3,(H,21,24)/b22-20- |
| InChIKey | HVJLXKODXZKVEH-XDOYNYLZSA-N |
| XLogP | 4.15 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|