C16H21N3O2S — CID 67347875
2-(2-cyclopropylimino-3-methyl-1,3-thiazolidin-4-yl)-N-(4-methoxyphenyl)acetamide (PubChem CID 67347875) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is 2-(2-cyclopropylimino-3-methyl-1,3-thiazolidin-4-yl)-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-(2-cyclopropylimino-3-methyl-1,3-thiazolidin-4-yl)-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 67347875 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 2-(2-cyclopropylimino-3-methyl-1,3-thiazolidin-4-yl)-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CC2CS/C(=N\C3CC3)N2C)cc1 |
| InChI | InChI=1S/C16H21N3O2S/c1-19-13(10-22-16(19)18-12-3-4-12)9-15(20)17-11-5-7-14(21-2)8-6-11/h5-8,12-13H,3-4,9-10H2,1-2H3,(H,17,20)/b18-16- |
| InChIKey | AYWQDPAKPMJHJM-VLGSPTGOSA-N |
| XLogP | 2.59 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|