C25H31N3O2S — CID 67346202
2-(2-cycloheptylimino-3-methyl-1,3-thiazolidin-4-yl)-N-(4-phenoxyphenyl)acetamide (PubChem CID 67346202) has the molecular formula C25H31N3O2S and a molecular weight of 437.61 g/mol. Its IUPAC name is 2-(2-cycloheptylimino-3-methyl-1,3-thiazolidin-4-yl)-N-(4-phenoxyphenyl)acetamide.
| Compound Name | 2-(2-cycloheptylimino-3-methyl-1,3-thiazolidin-4-yl)-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 67346202 |
| Molecular Formula | C25H31N3O2S |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 2-(2-cycloheptylimino-3-methyl-1,3-thiazolidin-4-yl)-N-(4-phenoxyphenyl)acetamide |
| SMILES | CN1/C(=N/C2CCCCCC2)SCC1CC(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C25H31N3O2S/c1-28-21(18-31-25(28)27-19-9-5-2-3-6-10-19)17-24(29)26-20-13-15-23(16-14-20)30-22-11-7-4-8-12-22/h4,7-8,11-16,19,21H,2-3,5-6,9-10,17-18H2,1H3,(H,26,29)/b27-25- |
| InChIKey | RJOMZSVFVQNVMJ-RFBIWTDZSA-N |
| XLogP | 5.93 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|