C24H29N3O2S — CID 140532175
2-cycloheptylimino-3-methyl-N-(4-phenoxyphenyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 140532175) has the molecular formula C24H29N3O2S and a molecular weight of 423.58 g/mol. Its IUPAC name is 2-cycloheptylimino-3-methyl-N-(4-phenoxyphenyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | 2-cycloheptylimino-3-methyl-N-(4-phenoxyphenyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 140532175 |
| Molecular Formula | C24H29N3O2S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 2-cycloheptylimino-3-methyl-N-(4-phenoxyphenyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CN1/C(=N/C2CCCCCC2)SCC1C(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C24H29N3O2S/c1-27-22(17-30-24(27)26-18-9-5-2-3-6-10-18)23(28)25-19-13-15-21(16-14-19)29-20-11-7-4-8-12-20/h4,7-8,11-16,18,22H,2-3,5-6,9-10,17H2,1H3,(H,25,28)/b26-24- |
| InChIKey | PSXKQHNDVZRAIK-LCUIJRPUSA-N |
| XLogP | 5.54 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|