C27H36ClN3O2S — CID 67350050
N-(3-butyl-2-cyclohexylimino-1,3-thiazolidin-4-yl)-N-(4-phenoxyphenyl)acetamide;hydrochloride (PubChem CID 67350050) has the molecular formula C27H36ClN3O2S and a molecular weight of 502.12 g/mol. Its IUPAC name is N-(3-butyl-2-cyclohexylimino-1,3-thiazolidin-4-yl)-N-(4-phenoxyphenyl)acetamide;hydrochloride.
| Compound Name | N-(3-butyl-2-cyclohexylimino-1,3-thiazolidin-4-yl)-N-(4-phenoxyphenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 67350050 |
| Molecular Formula | C27H36ClN3O2S |
| Molecular Weight | 502.12 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | N-(3-butyl-2-cyclohexylimino-1,3-thiazolidin-4-yl)-N-(4-phenoxyphenyl)acetamide;hydrochloride |
| SMILES | CCCCN1/C(=N/C2CCCCC2)SCC1N(C(C)=O)c1ccc(Oc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C27H35N3O2S.ClH/c1-3-4-19-29-26(20-33-27(29)28-22-11-7-5-8-12-22)30(21(2)31)23-15-17-25(18-16-23)32-24-13-9-6-10-14-24;/h6,9-10,13-18,22,26H,3-5,7-8,11-12,19-20H2,1-2H3;1H/b28-27-; |
| InChIKey | ATRBSUMQPMMHQY-LXCLTORNSA-N |
| XLogP | 7.12 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.12 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|