C29H37N3O2S — CID 67348424
N-(3-cyclohexyl-2-cyclohexylimino-1,3-thiazolidin-4-yl)-N-(4-phenoxyphenyl)acetamide (PubChem CID 67348424) has the molecular formula C29H37N3O2S and a molecular weight of 491.70 g/mol. Its IUPAC name is N-(3-cyclohexyl-2-cyclohexylimino-1,3-thiazolidin-4-yl)-N-(4-phenoxyphenyl)acetamide.
| Compound Name | N-(3-cyclohexyl-2-cyclohexylimino-1,3-thiazolidin-4-yl)-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 67348424 |
| Molecular Formula | C29H37N3O2S |
| Molecular Weight | 491.70 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | N-(3-cyclohexyl-2-cyclohexylimino-1,3-thiazolidin-4-yl)-N-(4-phenoxyphenyl)acetamide |
| SMILES | CC(=O)N(c1ccc(Oc2ccccc2)cc1)C1CS/C(=N\C2CCCCC2)N1C1CCCCC1 |
| InChI | InChI=1S/C29H37N3O2S/c1-22(33)31(25-17-19-27(20-18-25)34-26-15-9-4-10-16-26)28-21-35-29(30-23-11-5-2-6-12-23)32(28)24-13-7-3-8-14-24/h4,9-10,15-20,23-24,28H,2-3,5-8,11-14,21H2,1H3/b30-29- |
| InChIKey | VQOQSRJDBWZGPW-FLWNBWAVSA-N |
| XLogP | 7.23 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.70 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|