C19H26ClN3O2S — CID 67348328
N-(3-chloro-4-methoxyphenyl)-N-(2-cyclohexylimino-3-methyl-1,3-thiazolidin-4-yl)acetamide (PubChem CID 67348328) has the molecular formula C19H26ClN3O2S and a molecular weight of 395.96 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-N-(2-cyclohexylimino-3-methyl-1,3-thiazolidin-4-yl)acetamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-N-(2-cyclohexylimino-3-methyl-1,3-thiazolidin-4-yl)acetamide |
|---|---|
| PubChem CID | 67348328 |
| Molecular Formula | C19H26ClN3O2S |
| Molecular Weight | 395.96 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-N-(2-cyclohexylimino-3-methyl-1,3-thiazolidin-4-yl)acetamide |
| SMILES | COc1ccc(N(C(C)=O)C2CS/C(=N\C3CCCCC3)N2C)cc1Cl |
| InChI | InChI=1S/C19H26ClN3O2S/c1-13(24)23(15-9-10-17(25-3)16(20)11-15)18-12-26-19(22(18)2)21-14-7-5-4-6-8-14/h9-11,14,18H,4-8,12H2,1-3H3/b21-19- |
| InChIKey | MKAXCMYVEFKEJX-VZCXRCSSSA-N |
| XLogP | 4.39 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.96 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|