C22H28Cl3N3OS — CID 67347284
N-[2-(1-adamantylimino)-3-methyl-1,3-thiazolidin-4-yl]-N-(3,5-dichlorophenyl)acetamide;hydrochloride (PubChem CID 67347284) has the molecular formula C22H28Cl3N3OS and a molecular weight of 488.91 g/mol. Its IUPAC name is N-[2-(1-adamantylimino)-3-methyl-1,3-thiazolidin-4-yl]-N-(3,5-dichlorophenyl)acetamide;hydrochloride.
| Compound Name | N-[2-(1-adamantylimino)-3-methyl-1,3-thiazolidin-4-yl]-N-(3,5-dichlorophenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 67347284 |
| Molecular Formula | C22H28Cl3N3OS |
| Molecular Weight | 488.91 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | N-[2-(1-adamantylimino)-3-methyl-1,3-thiazolidin-4-yl]-N-(3,5-dichlorophenyl)acetamide;hydrochloride |
| SMILES | CC(=O)N(c1cc(Cl)cc(Cl)c1)C1CS/C(=N/C23CC4CC(CC(C4)C2)C3)N1C.Cl |
| InChI | InChI=1S/C22H27Cl2N3OS.ClH/c1-13(28)27(19-7-17(23)6-18(24)8-19)20-12-29-21(26(20)2)25-22-9-14-3-15(10-22)5-16(4-14)11-22;/h6-8,14-16,20H,3-5,9-12H2,1-2H3;1H/b25-21+; |
| InChIKey | UBAWKNHXHLUHOI-JMFMGIQESA-N |
| XLogP | 6.10 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.91 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|