C22H27ClFN3OS — CID 67347843
2-[2-(1-adamantylimino)-3-methyl-1,3-thiazolidin-4-yl]-N-(5-chloro-2-fluorophenyl)acetamide (PubChem CID 67347843) has the molecular formula C22H27ClFN3OS and a molecular weight of 436.00 g/mol. Its IUPAC name is 2-[2-(1-adamantylimino)-3-methyl-1,3-thiazolidin-4-yl]-N-(5-chloro-2-fluorophenyl)acetamide.
| Compound Name | 2-[2-(1-adamantylimino)-3-methyl-1,3-thiazolidin-4-yl]-N-(5-chloro-2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 67347843 |
| Molecular Formula | C22H27ClFN3OS |
| Molecular Weight | 436.00 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 2-[2-(1-adamantylimino)-3-methyl-1,3-thiazolidin-4-yl]-N-(5-chloro-2-fluorophenyl)acetamide |
| SMILES | CN1/C(=N/C23CC4CC(CC(C4)C2)C3)SCC1CC(=O)Nc1cc(Cl)ccc1F |
| InChI | InChI=1S/C22H27ClFN3OS/c1-27-17(8-20(28)25-19-7-16(23)2-3-18(19)24)12-29-21(27)26-22-9-13-4-14(10-22)6-15(5-13)11-22/h2-3,7,13-15,17H,4-6,8-12H2,1H3,(H,25,28)/b26-21- |
| InChIKey | FUGBADPCNBNAGS-QLYXXIJNSA-N |
| XLogP | 5.18 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.00 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|