C25H21ClFN3O2S — CID 2873025
[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] N-(3-chlorophenyl)-N'-(2-phenylethyl)carbamimidothioate (PubChem CID 2873025) has the molecular formula C25H21ClFN3O2S and a molecular weight of 481.98 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] N-(3-chlorophenyl)-N'-(2-phenylethyl)carbamimidothioate.
| Compound Name | [1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] N-(3-chlorophenyl)-N'-(2-phenylethyl)carbamimidothioate |
|---|---|
| PubChem CID | 2873025 |
| Molecular Formula | C25H21ClFN3O2S |
| Molecular Weight | 481.98 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | [1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl] N-(3-chlorophenyl)-N'-(2-phenylethyl)carbamimidothioate |
| SMILES | O=C1CC(S/C(=N/CCc2ccccc2)Nc2cccc(Cl)c2)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C25H21ClFN3O2S/c26-18-7-4-8-20(15-18)29-25(28-14-13-17-5-2-1-3-6-17)33-22-16-23(31)30(24(22)32)21-11-9-19(27)10-12-21/h1-12,15,22H,13-14,16H2,(H,28,29) |
| InChIKey | XITIBDZYLSWZEI-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.98 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|