C16H13ClFN3O4S — CID 2951519
1-(3-chloro-4-fluorophenyl)-3-[(5-ethyl-4-hydroxy-6-oxo-1H-pyrimidin-2-yl)sulfanyl]pyrrolidine-2,5-dione (PubChem CID 2951519) has the molecular formula C16H13ClFN3O4S and a molecular weight of 397.82 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[(5-ethyl-4-hydroxy-6-oxo-1H-pyrimidin-2-yl)sulfanyl]pyrrolidine-2,5-dione.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[(5-ethyl-4-hydroxy-6-oxo-1H-pyrimidin-2-yl)sulfanyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2951519 |
| Molecular Formula | C16H13ClFN3O4S |
| Molecular Weight | 397.82 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[(5-ethyl-4-hydroxy-6-oxo-1H-pyrimidin-2-yl)sulfanyl]pyrrolidine-2,5-dione |
| SMILES | CCc1c(O)nc(SC2CC(=O)N(c3ccc(F)c(Cl)c3)C2=O)[nH]c1=O |
| InChI | InChI=1S/C16H13ClFN3O4S/c1-2-8-13(23)19-16(20-14(8)24)26-11-6-12(22)21(15(11)25)7-3-4-10(18)9(17)5-7/h3-5,11H,2,6H2,1H3,(H2,19,20,23,24) |
| InChIKey | JRVKVJAFJRDCBQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.82 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|