C22H27ClFN3OS — CID 67347845
N-[2-(1-adamantylimino)-3-methyl-1,3-thiazolidin-4-yl]-N-(5-chloro-2-fluorophenyl)acetamide (PubChem CID 67347845) has the molecular formula C22H27ClFN3OS and a molecular weight of 436.00 g/mol. Its IUPAC name is N-[2-(1-adamantylimino)-3-methyl-1,3-thiazolidin-4-yl]-N-(5-chloro-2-fluorophenyl)acetamide.
| Compound Name | N-[2-(1-adamantylimino)-3-methyl-1,3-thiazolidin-4-yl]-N-(5-chloro-2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 67347845 |
| Molecular Formula | C22H27ClFN3OS |
| Molecular Weight | 436.00 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | N-[2-(1-adamantylimino)-3-methyl-1,3-thiazolidin-4-yl]-N-(5-chloro-2-fluorophenyl)acetamide |
| SMILES | CC(=O)N(c1cc(Cl)ccc1F)C1CS/C(=N/C23CC4CC(CC(C4)C2)C3)N1C |
| InChI | InChI=1S/C22H27ClFN3OS/c1-13(28)27(19-8-17(23)3-4-18(19)24)20-12-29-21(26(20)2)25-22-9-14-5-15(10-22)7-16(6-14)11-22/h3-4,8,14-16,20H,5-7,9-12H2,1-2H3/b25-21+ |
| InChIKey | BMZTUQXXEBQLEF-NJNXFGOHSA-N |
| XLogP | 5.16 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.00 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|