C28H41N3OS — CID 67350731
N-[2-(1-adamantylimino)-3-propan-2-yl-1,3-thiazolidin-4-yl]-N-(4-butylphenyl)acetamide (PubChem CID 67350731) has the molecular formula C28H41N3OS and a molecular weight of 467.72 g/mol. Its IUPAC name is N-[2-(1-adamantylimino)-3-propan-2-yl-1,3-thiazolidin-4-yl]-N-(4-butylphenyl)acetamide.
| Compound Name | N-[2-(1-adamantylimino)-3-propan-2-yl-1,3-thiazolidin-4-yl]-N-(4-butylphenyl)acetamide |
|---|---|
| PubChem CID | 67350731 |
| Molecular Formula | C28H41N3OS |
| Molecular Weight | 467.72 g/mol |
| Exact Mass | 467.30 |
| IUPAC Name | N-[2-(1-adamantylimino)-3-propan-2-yl-1,3-thiazolidin-4-yl]-N-(4-butylphenyl)acetamide |
| SMILES | CCCCc1ccc(N(C(C)=O)C2CS/C(=N\C34CC5CC(CC(C5)C3)C4)N2C(C)C)cc1 |
| InChI | InChI=1S/C28H41N3OS/c1-5-6-7-21-8-10-25(11-9-21)31(20(4)32)26-18-33-27(30(26)19(2)3)29-28-15-22-12-23(16-28)14-24(13-22)17-28/h8-11,19,22-24,26H,5-7,12-18H2,1-4H3/b29-27- |
| InChIKey | IIIHEJAFXOOWQT-OHYPFYFLSA-N |
| XLogP | 6.49 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.72 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|