C25H35N3OS — CID 67348653
2-[2-(1-adamantylimino)-3-propan-2-yl-1,3-thiazolidin-4-yl]-N-(4-methylphenyl)acetamide (PubChem CID 67348653) has the molecular formula C25H35N3OS and a molecular weight of 425.64 g/mol. Its IUPAC name is 2-[2-(1-adamantylimino)-3-propan-2-yl-1,3-thiazolidin-4-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-(1-adamantylimino)-3-propan-2-yl-1,3-thiazolidin-4-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 67348653 |
| Molecular Formula | C25H35N3OS |
| Molecular Weight | 425.64 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | 2-[2-(1-adamantylimino)-3-propan-2-yl-1,3-thiazolidin-4-yl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CC2CS/C(=N\C34CC5CC(CC(C5)C3)C4)N2C(C)C)cc1 |
| InChI | InChI=1S/C25H35N3OS/c1-16(2)28-22(11-23(29)26-21-6-4-17(3)5-7-21)15-30-24(28)27-25-12-18-8-19(13-25)10-20(9-18)14-25/h4-7,16,18-20,22H,8-15H2,1-3H3,(H,26,29)/b27-24- |
| InChIKey | YXNKPMLGXCGAHY-PNHLSOANSA-N |
| XLogP | 5.47 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.64 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|