C22H33N3OS — CID 67348562
2-(3-butyl-2-cyclohexylimino-1,3-thiazolidin-4-yl)-N-(4-methylphenyl)acetamide (PubChem CID 67348562) has the molecular formula C22H33N3OS and a molecular weight of 387.59 g/mol. Its IUPAC name is 2-(3-butyl-2-cyclohexylimino-1,3-thiazolidin-4-yl)-N-(4-methylphenyl)acetamide.
| Compound Name | 2-(3-butyl-2-cyclohexylimino-1,3-thiazolidin-4-yl)-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 67348562 |
| Molecular Formula | C22H33N3OS |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 2-(3-butyl-2-cyclohexylimino-1,3-thiazolidin-4-yl)-N-(4-methylphenyl)acetamide |
| SMILES | CCCCN1/C(=N/C2CCCCC2)SCC1CC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C22H33N3OS/c1-3-4-14-25-20(15-21(26)23-19-12-10-17(2)11-13-19)16-27-22(25)24-18-8-6-5-7-9-18/h10-13,18,20H,3-9,14-16H2,1-2H3,(H,23,26)/b24-22- |
| InChIKey | UUBWFHZFQIWVTI-GYHWCHFESA-N |
| XLogP | 5.23 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|