C18H23Cl2N3OS — CID 67347825
2-(2-cyclohexylimino-3-methyl-1,3-thiazolidin-4-yl)-N-(3,4-dichlorophenyl)acetamide (PubChem CID 67347825) has the molecular formula C18H23Cl2N3OS and a molecular weight of 400.38 g/mol. Its IUPAC name is 2-(2-cyclohexylimino-3-methyl-1,3-thiazolidin-4-yl)-N-(3,4-dichlorophenyl)acetamide.
| Compound Name | 2-(2-cyclohexylimino-3-methyl-1,3-thiazolidin-4-yl)-N-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 67347825 |
| Molecular Formula | C18H23Cl2N3OS |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 2-(2-cyclohexylimino-3-methyl-1,3-thiazolidin-4-yl)-N-(3,4-dichlorophenyl)acetamide |
| SMILES | CN1/C(=N/C2CCCCC2)SCC1CC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H23Cl2N3OS/c1-23-14(11-25-18(23)22-12-5-3-2-4-6-12)10-17(24)21-13-7-8-15(19)16(20)9-13/h7-9,12,14H,2-6,10-11H2,1H3,(H,21,24)/b22-18- |
| InChIKey | LAXHMFNRNTZQHC-PYCFMQQDSA-N |
| XLogP | 5.06 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|