C15H17Cl2N3OS — CID 67349502
2-(2-cyclopropylimino-3-methyl-1,3-thiazolidin-4-yl)-N-(3,5-dichlorophenyl)acetamide (PubChem CID 67349502) has the molecular formula C15H17Cl2N3OS and a molecular weight of 358.29 g/mol. Its IUPAC name is 2-(2-cyclopropylimino-3-methyl-1,3-thiazolidin-4-yl)-N-(3,5-dichlorophenyl)acetamide.
| Compound Name | 2-(2-cyclopropylimino-3-methyl-1,3-thiazolidin-4-yl)-N-(3,5-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 67349502 |
| Molecular Formula | C15H17Cl2N3OS |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 2-(2-cyclopropylimino-3-methyl-1,3-thiazolidin-4-yl)-N-(3,5-dichlorophenyl)acetamide |
| SMILES | CN1/C(=N/C2CC2)SCC1CC(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H17Cl2N3OS/c1-20-13(8-22-15(20)19-11-2-3-11)7-14(21)18-12-5-9(16)4-10(17)6-12/h4-6,11,13H,2-3,7-8H2,1H3,(H,18,21)/b19-15- |
| InChIKey | RERCKYUBIRGVQV-CYVLTUHYSA-N |
| XLogP | 3.89 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|