C15H17ClFN3OS — CID 67348368
N-(5-chloro-2-fluorophenyl)-2-(2-cyclopropylimino-3-methyl-1,3-thiazolidin-4-yl)acetamide (PubChem CID 67348368) has the molecular formula C15H17ClFN3OS and a molecular weight of 341.84 g/mol. Its IUPAC name is N-(5-chloro-2-fluorophenyl)-2-(2-cyclopropylimino-3-methyl-1,3-thiazolidin-4-yl)acetamide.
| Compound Name | N-(5-chloro-2-fluorophenyl)-2-(2-cyclopropylimino-3-methyl-1,3-thiazolidin-4-yl)acetamide |
|---|---|
| PubChem CID | 67348368 |
| Molecular Formula | C15H17ClFN3OS |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | N-(5-chloro-2-fluorophenyl)-2-(2-cyclopropylimino-3-methyl-1,3-thiazolidin-4-yl)acetamide |
| SMILES | CN1/C(=N/C2CC2)SCC1CC(=O)Nc1cc(Cl)ccc1F |
| InChI | InChI=1S/C15H17ClFN3OS/c1-20-11(8-22-15(20)18-10-3-4-10)7-14(21)19-13-6-9(16)2-5-12(13)17/h2,5-6,10-11H,3-4,7-8H2,1H3,(H,19,21)/b18-15- |
| InChIKey | GEJPAUXSMOVAOJ-SDXDJHTJSA-N |
| XLogP | 3.37 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|