C23H33Cl2N3OS — CID 67347786
N-(4-chlorophenyl)-2-(3-cyclohexyl-2-cyclohexylimino-1,3-thiazolidin-4-yl)acetamide;hydrochloride (PubChem CID 67347786) has the molecular formula C23H33Cl2N3OS and a molecular weight of 470.51 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(3-cyclohexyl-2-cyclohexylimino-1,3-thiazolidin-4-yl)acetamide;hydrochloride.
| Compound Name | N-(4-chlorophenyl)-2-(3-cyclohexyl-2-cyclohexylimino-1,3-thiazolidin-4-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 67347786 |
| Molecular Formula | C23H33Cl2N3OS |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | N-(4-chlorophenyl)-2-(3-cyclohexyl-2-cyclohexylimino-1,3-thiazolidin-4-yl)acetamide;hydrochloride |
| SMILES | Cl.O=C(CC1CS/C(=N\C2CCCCC2)N1C1CCCCC1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H32ClN3OS.ClH/c24-17-11-13-19(14-12-17)25-22(28)15-21-16-29-23(26-18-7-3-1-4-8-18)27(21)20-9-5-2-6-10-20;/h11-14,18,20-21H,1-10,15-16H2,(H,25,28);1H/b26-23-; |
| InChIKey | ZOTABBUHMBXXDZ-NYIQPMNJSA-N |
| XLogP | 6.53 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|