C18H24BrN3OS — CID 67348468
N-(4-bromophenyl)-2-(2-cyclohexylimino-3-methyl-1,3-thiazolidin-4-yl)acetamide (PubChem CID 67348468) has the molecular formula C18H24BrN3OS and a molecular weight of 410.38 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-(2-cyclohexylimino-3-methyl-1,3-thiazolidin-4-yl)acetamide.
| Compound Name | N-(4-bromophenyl)-2-(2-cyclohexylimino-3-methyl-1,3-thiazolidin-4-yl)acetamide |
|---|---|
| PubChem CID | 67348468 |
| Molecular Formula | C18H24BrN3OS |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | N-(4-bromophenyl)-2-(2-cyclohexylimino-3-methyl-1,3-thiazolidin-4-yl)acetamide |
| SMILES | CN1/C(=N/C2CCCCC2)SCC1CC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C18H24BrN3OS/c1-22-16(11-17(23)20-15-9-7-13(19)8-10-15)12-24-18(22)21-14-5-3-2-4-6-14/h7-10,14,16H,2-6,11-12H2,1H3,(H,20,23)/b21-18- |
| InChIKey | VKLMWVLCUSXVJM-UZYVYHOESA-N |
| XLogP | 4.51 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|