C19H24F3N3OS — CID 67351201
2-(2-cyclohexylimino-3-methyl-1,3-thiazolidin-4-yl)-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 67351201) has the molecular formula C19H24F3N3OS and a molecular weight of 399.48 g/mol. Its IUPAC name is 2-(2-cyclohexylimino-3-methyl-1,3-thiazolidin-4-yl)-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(2-cyclohexylimino-3-methyl-1,3-thiazolidin-4-yl)-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 67351201 |
| Molecular Formula | C19H24F3N3OS |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 2-(2-cyclohexylimino-3-methyl-1,3-thiazolidin-4-yl)-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | CN1/C(=N/C2CCCCC2)SCC1CC(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H24F3N3OS/c1-25-16(12-27-18(25)24-14-5-3-2-4-6-14)11-17(26)23-15-9-7-13(8-10-15)19(20,21)22/h7-10,14,16H,2-6,11-12H2,1H3,(H,23,26)/b24-18- |
| InChIKey | JOVCAXGBBHCSAD-MOHJPFBDSA-N |
| XLogP | 4.77 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|