C22H25F6N3OS — CID 87365465
N-[3,5-bis(trifluoromethyl)phenyl]-2-(2-cyclohexylimino-3-cyclopropyl-1,3-thiazolidin-4-yl)acetamide (PubChem CID 87365465) has the molecular formula C22H25F6N3OS and a molecular weight of 493.52 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-2-(2-cyclohexylimino-3-cyclopropyl-1,3-thiazolidin-4-yl)acetamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-(2-cyclohexylimino-3-cyclopropyl-1,3-thiazolidin-4-yl)acetamide |
|---|---|
| PubChem CID | 87365465 |
| Molecular Formula | C22H25F6N3OS |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-(2-cyclohexylimino-3-cyclopropyl-1,3-thiazolidin-4-yl)acetamide |
| SMILES | O=C(CC1CS/C(=N\C2CCCCC2)N1C1CC1)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H25F6N3OS/c23-21(24,25)13-8-14(22(26,27)28)10-16(9-13)29-19(32)11-18-12-33-20(31(18)17-6-7-17)30-15-4-2-1-3-5-15/h8-10,15,17-18H,1-7,11-12H2,(H,29,32)/b30-20- |
| InChIKey | LHYJKKXPKQGZKZ-COEJQBHMSA-N |
| XLogP | 6.32 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|