C21H31N3OS — CID 67347610
2-(2-cycloheptylimino-3-methyl-1,3-thiazolidin-4-yl)-N-(4-ethylphenyl)acetamide (PubChem CID 67347610) has the molecular formula C21H31N3OS and a molecular weight of 373.57 g/mol. Its IUPAC name is 2-(2-cycloheptylimino-3-methyl-1,3-thiazolidin-4-yl)-N-(4-ethylphenyl)acetamide.
| Compound Name | 2-(2-cycloheptylimino-3-methyl-1,3-thiazolidin-4-yl)-N-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 67347610 |
| Molecular Formula | C21H31N3OS |
| Molecular Weight | 373.57 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 2-(2-cycloheptylimino-3-methyl-1,3-thiazolidin-4-yl)-N-(4-ethylphenyl)acetamide |
| SMILES | CCc1ccc(NC(=O)CC2CS/C(=N\C3CCCCCC3)N2C)cc1 |
| InChI | InChI=1S/C21H31N3OS/c1-3-16-10-12-18(13-11-16)22-20(25)14-19-15-26-21(24(19)2)23-17-8-6-4-5-7-9-17/h10-13,17,19H,3-9,14-15H2,1-2H3,(H,22,25)/b23-21- |
| InChIKey | VDIHLQVYGWZPPK-LNVKXUELSA-N |
| XLogP | 4.70 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.57 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|