C23H35N3OS — CID 67350989
N-(4-butylphenyl)-2-(2-cycloheptylimino-3-methyl-1,3-thiazolidin-4-yl)acetamide (PubChem CID 67350989) has the molecular formula C23H35N3OS and a molecular weight of 401.62 g/mol. Its IUPAC name is N-(4-butylphenyl)-2-(2-cycloheptylimino-3-methyl-1,3-thiazolidin-4-yl)acetamide.
| Compound Name | N-(4-butylphenyl)-2-(2-cycloheptylimino-3-methyl-1,3-thiazolidin-4-yl)acetamide |
|---|---|
| PubChem CID | 67350989 |
| Molecular Formula | C23H35N3OS |
| Molecular Weight | 401.62 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | N-(4-butylphenyl)-2-(2-cycloheptylimino-3-methyl-1,3-thiazolidin-4-yl)acetamide |
| SMILES | CCCCc1ccc(NC(=O)CC2CS/C(=N\C3CCCCCC3)N2C)cc1 |
| InChI | InChI=1S/C23H35N3OS/c1-3-4-9-18-12-14-20(15-13-18)24-22(27)16-21-17-28-23(26(21)2)25-19-10-7-5-6-8-11-19/h12-15,19,21H,3-11,16-17H2,1-2H3,(H,24,27)/b25-23- |
| InChIKey | LLJANHBHDWBODK-BZZOAKBMSA-N |
| XLogP | 5.48 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.62 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|