C26H37N3OS — CID 67349153
2-[2-(2-adamantylimino)-3-methyl-1,3-thiazolidin-4-yl]-N-(4-butylphenyl)acetamide (PubChem CID 67349153) has the molecular formula C26H37N3OS and a molecular weight of 439.67 g/mol. Its IUPAC name is 2-[2-(2-adamantylimino)-3-methyl-1,3-thiazolidin-4-yl]-N-(4-butylphenyl)acetamide.
| Compound Name | 2-[2-(2-adamantylimino)-3-methyl-1,3-thiazolidin-4-yl]-N-(4-butylphenyl)acetamide |
|---|---|
| PubChem CID | 67349153 |
| Molecular Formula | C26H37N3OS |
| Molecular Weight | 439.67 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | 2-[2-(2-adamantylimino)-3-methyl-1,3-thiazolidin-4-yl]-N-(4-butylphenyl)acetamide |
| SMILES | CCCCc1ccc(NC(=O)CC2CS/C(=N/C3C4CC5CC(C4)CC3C5)N2C)cc1 |
| InChI | InChI=1S/C26H37N3OS/c1-3-4-5-17-6-8-22(9-7-17)27-24(30)15-23-16-31-26(29(23)2)28-25-20-11-18-10-19(13-20)14-21(25)12-18/h6-9,18-21,23,25H,3-5,10-16H2,1-2H3,(H,27,30)/b28-26+ |
| InChIKey | UTVJDZWPSQZMPI-BYCLXTJYSA-N |
| XLogP | 5.59 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.67 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|