C29H44ClN3OS — CID 67348291
2-[2-(1-adamantylimino)-3-butyl-1,3-thiazolidin-4-yl]-N-(4-butylphenyl)acetamide;hydrochloride (PubChem CID 67348291) has the molecular formula C29H44ClN3OS and a molecular weight of 518.21 g/mol. Its IUPAC name is 2-[2-(1-adamantylimino)-3-butyl-1,3-thiazolidin-4-yl]-N-(4-butylphenyl)acetamide;hydrochloride.
| Compound Name | 2-[2-(1-adamantylimino)-3-butyl-1,3-thiazolidin-4-yl]-N-(4-butylphenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 67348291 |
| Molecular Formula | C29H44ClN3OS |
| Molecular Weight | 518.21 g/mol |
| Exact Mass | 517.29 |
| IUPAC Name | 2-[2-(1-adamantylimino)-3-butyl-1,3-thiazolidin-4-yl]-N-(4-butylphenyl)acetamide;hydrochloride |
| SMILES | CCCCc1ccc(NC(=O)CC2CS/C(=N\C34CC5CC(CC(C5)C3)C4)N2CCCC)cc1.Cl |
| InChI | InChI=1S/C29H43N3OS.ClH/c1-3-5-7-21-8-10-25(11-9-21)30-27(33)16-26-20-34-28(32(26)12-6-4-2)31-29-17-22-13-23(18-29)15-24(14-22)19-29;/h8-11,22-24,26H,3-7,12-20H2,1-2H3,(H,30,33);1H/b31-28-; |
| InChIKey | ZQYVPMSRQWVZFG-GIBMLHLSSA-N |
| XLogP | 7.32 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.21 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|