C25H36ClN3OS — CID 67349545
2-[2-(1-adamantylimino)-3-ethyl-1,3-thiazolidin-4-yl]-N-(4-ethylphenyl)acetamide;hydrochloride (PubChem CID 67349545) has the molecular formula C25H36ClN3OS and a molecular weight of 462.10 g/mol. Its IUPAC name is 2-[2-(1-adamantylimino)-3-ethyl-1,3-thiazolidin-4-yl]-N-(4-ethylphenyl)acetamide;hydrochloride.
| Compound Name | 2-[2-(1-adamantylimino)-3-ethyl-1,3-thiazolidin-4-yl]-N-(4-ethylphenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 67349545 |
| Molecular Formula | C25H36ClN3OS |
| Molecular Weight | 462.10 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 2-[2-(1-adamantylimino)-3-ethyl-1,3-thiazolidin-4-yl]-N-(4-ethylphenyl)acetamide;hydrochloride |
| SMILES | CCc1ccc(NC(=O)CC2CS/C(=N\C34CC5CC(CC(C5)C3)C4)N2CC)cc1.Cl |
| InChI | InChI=1S/C25H35N3OS.ClH/c1-3-17-5-7-21(8-6-17)26-23(29)12-22-16-30-24(28(22)4-2)27-25-13-18-9-19(14-25)11-20(10-18)15-25;/h5-8,18-20,22H,3-4,9-16H2,1-2H3,(H,26,29);1H/b27-24-; |
| InChIKey | IORZURBBCYAHPK-XLKZBTFOSA-N |
| XLogP | 5.76 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.10 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|