C26H31F6N3OS — CID 87365569
2-[2-(1-adamantylimino)-3-propan-2-yl-1,3-thiazolidin-4-yl]-N-[3,5-bis(trifluoromethyl)phenyl]acetamide (PubChem CID 87365569) has the molecular formula C26H31F6N3OS and a molecular weight of 547.61 g/mol. Its IUPAC name is 2-[2-(1-adamantylimino)-3-propan-2-yl-1,3-thiazolidin-4-yl]-N-[3,5-bis(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[2-(1-adamantylimino)-3-propan-2-yl-1,3-thiazolidin-4-yl]-N-[3,5-bis(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 87365569 |
| Molecular Formula | C26H31F6N3OS |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.21 |
| IUPAC Name | 2-[2-(1-adamantylimino)-3-propan-2-yl-1,3-thiazolidin-4-yl]-N-[3,5-bis(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(C)N1/C(=N/C23CC4CC(CC(C4)C2)C3)SCC1CC(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H31F6N3OS/c1-14(2)35-21(13-37-23(35)34-24-10-15-3-16(11-24)5-17(4-15)12-24)9-22(36)33-20-7-18(25(27,28)29)6-19(8-20)26(30,31)32/h6-8,14-17,21H,3-5,9-13H2,1-2H3,(H,33,36)/b34-23- |
| InChIKey | AZVVMGVDILWATO-XSVYLIDLSA-N |
| XLogP | 7.20 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|