C20H27F2N3OS — CID 67346323
2-(2-cyclohexylimino-3,5-dimethyl-1,3-thiazolidin-4-yl)-N-[3-(difluoromethyl)phenyl]acetamide (PubChem CID 67346323) has the molecular formula C20H27F2N3OS and a molecular weight of 395.52 g/mol. Its IUPAC name is 2-(2-cyclohexylimino-3,5-dimethyl-1,3-thiazolidin-4-yl)-N-[3-(difluoromethyl)phenyl]acetamide.
| Compound Name | 2-(2-cyclohexylimino-3,5-dimethyl-1,3-thiazolidin-4-yl)-N-[3-(difluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 67346323 |
| Molecular Formula | C20H27F2N3OS |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 2-(2-cyclohexylimino-3,5-dimethyl-1,3-thiazolidin-4-yl)-N-[3-(difluoromethyl)phenyl]acetamide |
| SMILES | CC1S/C(=N\C2CCCCC2)N(C)C1CC(=O)Nc1cccc(C(F)F)c1 |
| InChI | InChI=1S/C20H27F2N3OS/c1-13-17(25(2)20(27-13)24-15-8-4-3-5-9-15)12-18(26)23-16-10-6-7-14(11-16)19(21)22/h6-7,10-11,13,15,17,19H,3-5,8-9,12H2,1-2H3,(H,23,26)/b24-20- |
| InChIKey | XLYQYUHDZDTJFL-GFMRDNFCSA-N |
| XLogP | 5.08 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|