C22H21F6N3OS — CID 87366373
N-[3,5-bis(trifluoromethyl)phenyl]-2-[3-methyl-2-(2-phenylethylimino)-1,3-thiazolidin-4-yl]acetamide (PubChem CID 87366373) has the molecular formula C22H21F6N3OS and a molecular weight of 489.49 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-2-[3-methyl-2-(2-phenylethylimino)-1,3-thiazolidin-4-yl]acetamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-[3-methyl-2-(2-phenylethylimino)-1,3-thiazolidin-4-yl]acetamide |
|---|---|
| PubChem CID | 87366373 |
| Molecular Formula | C22H21F6N3OS |
| Molecular Weight | 489.49 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-[3-methyl-2-(2-phenylethylimino)-1,3-thiazolidin-4-yl]acetamide |
| SMILES | CN1/C(=N/CCc2ccccc2)SCC1CC(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H21F6N3OS/c1-31-18(13-33-20(31)29-8-7-14-5-3-2-4-6-14)12-19(32)30-17-10-15(21(23,24)25)9-16(11-17)22(26,27)28/h2-6,9-11,18H,7-8,12-13H2,1H3,(H,30,32)/b29-20- |
| InChIKey | RZZGGSVWQDYCSE-BRPDVVIDSA-N |
| XLogP | 5.70 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.49 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|