C18H23F2N3OS — CID 140532192
2-cycloheptylimino-N-(3,4-difluorophenyl)-3-methyl-1,3-thiazolidine-4-carboxamide (PubChem CID 140532192) has the molecular formula C18H23F2N3OS and a molecular weight of 367.47 g/mol. Its IUPAC name is 2-cycloheptylimino-N-(3,4-difluorophenyl)-3-methyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | 2-cycloheptylimino-N-(3,4-difluorophenyl)-3-methyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 140532192 |
| Molecular Formula | C18H23F2N3OS |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 2-cycloheptylimino-N-(3,4-difluorophenyl)-3-methyl-1,3-thiazolidine-4-carboxamide |
| SMILES | CN1/C(=N/C2CCCCCC2)SCC1C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H23F2N3OS/c1-23-16(17(24)21-13-8-9-14(19)15(20)10-13)11-25-18(23)22-12-6-4-2-3-5-7-12/h8-10,12,16H,2-7,11H2,1H3,(H,21,24)/b22-18- |
| InChIKey | COUIEVLXEFVJRG-PYCFMQQDSA-N |
| XLogP | 4.03 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|