C18H23FN4O3S — CID 67348583
4-(2-cycloheptylimino-3-methyl-1,3-thiazolidin-4-yl)-2-fluoro-5-nitrobenzamide (PubChem CID 67348583) has the molecular formula C18H23FN4O3S and a molecular weight of 394.47 g/mol. Its IUPAC name is 4-(2-cycloheptylimino-3-methyl-1,3-thiazolidin-4-yl)-2-fluoro-5-nitrobenzamide.
| Compound Name | 4-(2-cycloheptylimino-3-methyl-1,3-thiazolidin-4-yl)-2-fluoro-5-nitrobenzamide |
|---|---|
| PubChem CID | 67348583 |
| Molecular Formula | C18H23FN4O3S |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 4-(2-cycloheptylimino-3-methyl-1,3-thiazolidin-4-yl)-2-fluoro-5-nitrobenzamide |
| SMILES | CN1/C(=N\C2CCCCCC2)SCC1c1cc(F)c(C(N)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H23FN4O3S/c1-22-16(10-27-18(22)21-11-6-4-2-3-5-7-11)13-8-14(19)12(17(20)24)9-15(13)23(25)26/h8-9,11,16H,2-7,10H2,1H3,(H2,20,24)/b21-18+ |
| InChIKey | SGKAVEJPZAXLGC-DYTRJAOYSA-N |
| XLogP | 3.63 |
| TPSA | 101.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|